C12H13FINO3S — CID 104519526
N-(4-fluoro-2-iodophenyl)-1,1-dioxothiane-2-carboxamide (PubChem CID 104519526) has the molecular formula C12H13FINO3S and a molecular weight of 397.21 g/mol. Its IUPAC name is N-(4-fluoro-2-iodophenyl)-1,1-dioxothiane-2-carboxamide.
| Compound Name | N-(4-fluoro-2-iodophenyl)-1,1-dioxothiane-2-carboxamide |
|---|---|
| PubChem CID | 104519526 |
| Molecular Formula | C12H13FINO3S |
| Molecular Weight | 397.21 g/mol |
| Exact Mass | 396.96 |
| IUPAC Name | N-(4-fluoro-2-iodophenyl)-1,1-dioxothiane-2-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1I)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C12H13FINO3S/c13-8-4-5-10(9(14)7-8)15-12(16)11-3-1-2-6-19(11,17)18/h4-5,7,11H,1-3,6H2,(H,15,16) |
| InChIKey | VSPQQLURXLORSX-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.21 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|