C14H17FINO — CID 104918053
N-(4-fluoro-2-iodophenyl)-2,2-dimethylcyclopentane-1-carboxamide (PubChem CID 104918053) has the molecular formula C14H17FINO and a molecular weight of 361.20 g/mol. Its IUPAC name is N-(4-fluoro-2-iodophenyl)-2,2-dimethylcyclopentane-1-carboxamide.
| Compound Name | N-(4-fluoro-2-iodophenyl)-2,2-dimethylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 104918053 |
| Molecular Formula | C14H17FINO |
| Molecular Weight | 361.20 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | N-(4-fluoro-2-iodophenyl)-2,2-dimethylcyclopentane-1-carboxamide |
| SMILES | CC1(C)CCCC1C(=O)Nc1ccc(F)cc1I |
| InChI | InChI=1S/C14H17FINO/c1-14(2)7-3-4-10(14)13(18)17-12-6-5-9(15)8-11(12)16/h5-6,8,10H,3-4,7H2,1-2H3,(H,17,18) |
| InChIKey | MLTPEXDDRRBGKK-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.20 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|