C12H11FINO3 — CID 79766775
1-[(4-fluoro-2-iodophenyl)carbamoyl]cyclobutane-1-carboxylic acid (PubChem CID 79766775) has the molecular formula C12H11FINO3 and a molecular weight of 363.13 g/mol. Its IUPAC name is 1-[(4-fluoro-2-iodophenyl)carbamoyl]cyclobutane-1-carboxylic acid.
| Compound Name | 1-[(4-fluoro-2-iodophenyl)carbamoyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 79766775 |
| Molecular Formula | C12H11FINO3 |
| Molecular Weight | 363.13 g/mol |
| Exact Mass | 362.98 |
| IUPAC Name | 1-[(4-fluoro-2-iodophenyl)carbamoyl]cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1(C(=O)Nc2ccc(F)cc2I)CCC1 |
| InChI | InChI=1S/C12H11FINO3/c13-7-2-3-9(8(14)6-7)15-10(16)12(11(17)18)4-1-5-12/h2-3,6H,1,4-5H2,(H,15,16)(H,17,18) |
| InChIKey | QVWDTHWVTPDNGY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.13 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|