C11H9ClFNO3 — CID 103552439
1-[(2-chloro-5-fluorophenyl)carbamoyl]cyclopropane-1-carboxylic acid (PubChem CID 103552439) has the molecular formula C11H9ClFNO3 and a molecular weight of 257.65 g/mol. Its IUPAC name is 1-[(2-chloro-5-fluorophenyl)carbamoyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[(2-chloro-5-fluorophenyl)carbamoyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 103552439 |
| Molecular Formula | C11H9ClFNO3 |
| Molecular Weight | 257.65 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | 1-[(2-chloro-5-fluorophenyl)carbamoyl]cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)C1(C(=O)Nc2cc(F)ccc2Cl)CC1 |
| InChI | InChI=1S/C11H9ClFNO3/c12-7-2-1-6(13)5-8(7)14-9(15)11(3-4-11)10(16)17/h1-2,5H,3-4H2,(H,14,15)(H,16,17) |
| InChIKey | ZJNCVKSQOTZNDI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.65 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|