C14H15ClFNO4 — CID 154871885
1-[(5-chloro-2-fluoro-4-hydroxyphenyl)carbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 154871885) has the molecular formula C14H15ClFNO4 and a molecular weight of 315.73 g/mol. Its IUPAC name is 1-[(5-chloro-2-fluoro-4-hydroxyphenyl)carbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[(5-chloro-2-fluoro-4-hydroxyphenyl)carbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 154871885 |
| Molecular Formula | C14H15ClFNO4 |
| Molecular Weight | 315.73 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 1-[(5-chloro-2-fluoro-4-hydroxyphenyl)carbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1(C(=O)Nc2cc(Cl)c(O)cc2F)CCCCC1 |
| InChI | InChI=1S/C14H15ClFNO4/c15-8-6-10(9(16)7-11(8)18)17-12(19)14(13(20)21)4-2-1-3-5-14/h6-7,18H,1-5H2,(H,17,19)(H,20,21) |
| InChIKey | JYUZURJKSGZOQI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.73 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|