C12H10ClF2NO3 — CID 83087352
1-[(2-chloro-4,6-difluorophenyl)carbamoyl]cyclobutane-1-carboxylic acid (PubChem CID 83087352) has the molecular formula C12H10ClF2NO3 and a molecular weight of 289.66 g/mol. Its IUPAC name is 1-[(2-chloro-4,6-difluorophenyl)carbamoyl]cyclobutane-1-carboxylic acid.
| Compound Name | 1-[(2-chloro-4,6-difluorophenyl)carbamoyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 83087352 |
| Molecular Formula | C12H10ClF2NO3 |
| Molecular Weight | 289.66 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 1-[(2-chloro-4,6-difluorophenyl)carbamoyl]cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1(C(=O)Nc2c(F)cc(F)cc2Cl)CCC1 |
| InChI | InChI=1S/C12H10ClF2NO3/c13-7-4-6(14)5-8(15)9(7)16-10(17)12(11(18)19)2-1-3-12/h4-5H,1-3H2,(H,16,17)(H,18,19) |
| InChIKey | BZATTWUOGYISQE-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.66 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|