C13H15ClF2N2O — CID 104597189
N-(2-chloro-4,6-difluorophenyl)-2-methylpiperidine-2-carboxamide (PubChem CID 104597189) has the molecular formula C13H15ClF2N2O and a molecular weight of 288.72 g/mol. Its IUPAC name is N-(2-chloro-4,6-difluorophenyl)-2-methylpiperidine-2-carboxamide.
| Compound Name | N-(2-chloro-4,6-difluorophenyl)-2-methylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 104597189 |
| Molecular Formula | C13H15ClF2N2O |
| Molecular Weight | 288.72 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | N-(2-chloro-4,6-difluorophenyl)-2-methylpiperidine-2-carboxamide |
| SMILES | CC1(C(=O)Nc2c(F)cc(F)cc2Cl)CCCCN1 |
| InChI | InChI=1S/C13H15ClF2N2O/c1-13(4-2-3-5-17-13)12(19)18-11-9(14)6-8(15)7-10(11)16/h6-7,17H,2-5H2,1H3,(H,18,19) |
| InChIKey | DCHMDMIDZUMSBO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.72 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |