C15H21BrN2O — CID 104597094
N-(2-bromo-4,6-dimethylphenyl)-2-methylpiperidine-2-carboxamide (PubChem CID 104597094) has the molecular formula C15H21BrN2O and a molecular weight of 325.25 g/mol. Its IUPAC name is N-(2-bromo-4,6-dimethylphenyl)-2-methylpiperidine-2-carboxamide.
| Compound Name | N-(2-bromo-4,6-dimethylphenyl)-2-methylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 104597094 |
| Molecular Formula | C15H21BrN2O |
| Molecular Weight | 325.25 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | N-(2-bromo-4,6-dimethylphenyl)-2-methylpiperidine-2-carboxamide |
| SMILES | Cc1cc(C)c(NC(=O)C2(C)CCCCN2)c(Br)c1 |
| InChI | InChI=1S/C15H21BrN2O/c1-10-8-11(2)13(12(16)9-10)18-14(19)15(3)6-4-5-7-17-15/h8-9,17H,4-7H2,1-3H3,(H,18,19) |
| InChIKey | SSEHFXQMQUKTRK-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.25 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |