C13H13F5N2O — CID 104597136
2-methyl-N-(2,3,4,5,6-pentafluorophenyl)piperidine-2-carboxamide (PubChem CID 104597136) has the molecular formula C13H13F5N2O and a molecular weight of 308.25 g/mol. Its IUPAC name is 2-methyl-N-(2,3,4,5,6-pentafluorophenyl)piperidine-2-carboxamide.
| Compound Name | 2-methyl-N-(2,3,4,5,6-pentafluorophenyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 104597136 |
| Molecular Formula | C13H13F5N2O |
| Molecular Weight | 308.25 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 2-methyl-N-(2,3,4,5,6-pentafluorophenyl)piperidine-2-carboxamide |
| SMILES | CC1(C(=O)Nc2c(F)c(F)c(F)c(F)c2F)CCCCN1 |
| InChI | InChI=1S/C13H13F5N2O/c1-13(4-2-3-5-19-13)12(21)20-11-9(17)7(15)6(14)8(16)10(11)18/h19H,2-5H2,1H3,(H,20,21) |
| InChIKey | YQVHJZGNWBOMNY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.25 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|