C9H19N3O — CID 104597181
N',N',2-trimethylpiperidine-2-carbohydrazide (PubChem CID 104597181) has the molecular formula C9H19N3O and a molecular weight of 185.27 g/mol. Its IUPAC name is N',N',2-trimethylpiperidine-2-carbohydrazide.
| Compound Name | N',N',2-trimethylpiperidine-2-carbohydrazide |
|---|---|
| PubChem CID | 104597181 |
| Molecular Formula | C9H19N3O |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.15 |
| IUPAC Name | N',N',2-trimethylpiperidine-2-carbohydrazide |
| SMILES | CN(C)NC(=O)C1(C)CCCCN1 |
| InChI | InChI=1S/C9H19N3O/c1-9(6-4-5-7-10-9)8(13)11-12(2)3/h10H,4-7H2,1-3H3,(H,11,13) |
| InChIKey | JJCYSJWRKMIJPG-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|