C10H16F4N2O — CID 114169272
2-methyl-N-(2,2,3,3-tetrafluoropropyl)piperidine-2-carboxamide (PubChem CID 114169272) has the molecular formula C10H16F4N2O and a molecular weight of 256.24 g/mol. Its IUPAC name is 2-methyl-N-(2,2,3,3-tetrafluoropropyl)piperidine-2-carboxamide.
| Compound Name | 2-methyl-N-(2,2,3,3-tetrafluoropropyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 114169272 |
| Molecular Formula | C10H16F4N2O |
| Molecular Weight | 256.24 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 2-methyl-N-(2,2,3,3-tetrafluoropropyl)piperidine-2-carboxamide |
| SMILES | CC1(C(=O)NCC(F)(F)C(F)F)CCCCN1 |
| InChI | InChI=1S/C10H16F4N2O/c1-9(4-2-3-5-16-9)8(17)15-6-10(13,14)7(11)12/h7,16H,2-6H2,1H3,(H,15,17) |
| InChIKey | DVXXLHMBDCEYGZ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.24 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|