C10H9F9N2O2 — CID 549839
N-[3-(difluoromethyl)-2-oxopiperidin-3-yl]-2,2,3,3,4,4,4-heptafluorobutanamide (PubChem CID 549839) has the molecular formula C10H9F9N2O2 and a molecular weight of 360.18 g/mol. Its IUPAC name is N-[3-(difluoromethyl)-2-oxopiperidin-3-yl]-2,2,3,3,4,4,4-heptafluorobutanamide.
| Compound Name | N-[3-(difluoromethyl)-2-oxopiperidin-3-yl]-2,2,3,3,4,4,4-heptafluorobutanamide |
|---|---|
| PubChem CID | 549839 |
| Molecular Formula | C10H9F9N2O2 |
| Molecular Weight | 360.18 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | N-[3-(difluoromethyl)-2-oxopiperidin-3-yl]-2,2,3,3,4,4,4-heptafluorobutanamide |
| SMILES | O=C1NCCCC1(NC(=O)C(F)(F)C(F)(F)C(F)(F)F)C(F)F |
| InChI | InChI=1S/C10H9F9N2O2/c11-4(12)7(2-1-3-20-5(7)22)21-6(23)8(13,14)9(15,16)10(17,18)19/h4H,1-3H2,(H,20,22)(H,21,23) |
| InChIKey | QPSMVFTZLSABDD-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.18 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|