C12H12BrClFN3O2 — CID 107615208
N-(2-bromo-6-chloro-4-fluorophenyl)-1-(N'-hydroxycarbamimidoyl)cyclobutane-1-carboxamide (PubChem CID 107615208) has the molecular formula C12H12BrClFN3O2 and a molecular weight of 364.60 g/mol. Its IUPAC name is N-(2-bromo-6-chloro-4-fluorophenyl)-1-(N'-hydroxycarbamimidoyl)cyclobutane-1-carboxamide.
| Compound Name | N-(2-bromo-6-chloro-4-fluorophenyl)-1-(N'-hydroxycarbamimidoyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 107615208 |
| Molecular Formula | C12H12BrClFN3O2 |
| Molecular Weight | 364.60 g/mol |
| Exact Mass | 362.98 |
| IUPAC Name | N-(2-bromo-6-chloro-4-fluorophenyl)-1-(N'-hydroxycarbamimidoyl)cyclobutane-1-carboxamide |
| SMILES | NC(=NO)C1(C(=O)Nc2c(Cl)cc(F)cc2Br)CCC1 |
| InChI | InChI=1S/C12H12BrClFN3O2/c13-7-4-6(15)5-8(14)9(7)17-11(19)12(2-1-3-12)10(16)18-20/h4-5,20H,1-3H2,(H2,16,18)(H,17,19) |
| InChIKey | LXEUQUQQPGROPM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.60 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|