C10H10BrClFN3O2 — CID 107615200
3-amino-N-(2-bromo-6-chloro-4-fluorophenyl)-3-hydroxyimino-2-methylpropanamide (PubChem CID 107615200) has the molecular formula C10H10BrClFN3O2 and a molecular weight of 338.56 g/mol. Its IUPAC name is 3-amino-N-(2-bromo-6-chloro-4-fluorophenyl)-3-hydroxyimino-2-methylpropanamide.
| Compound Name | 3-amino-N-(2-bromo-6-chloro-4-fluorophenyl)-3-hydroxyimino-2-methylpropanamide |
|---|---|
| PubChem CID | 107615200 |
| Molecular Formula | C10H10BrClFN3O2 |
| Molecular Weight | 338.56 g/mol |
| Exact Mass | 336.96 |
| IUPAC Name | 3-amino-N-(2-bromo-6-chloro-4-fluorophenyl)-3-hydroxyimino-2-methylpropanamide |
| SMILES | CC(C(=O)Nc1c(Cl)cc(F)cc1Br)C(N)=NO |
| InChI | InChI=1S/C10H10BrClFN3O2/c1-4(9(14)16-18)10(17)15-8-6(11)2-5(13)3-7(8)12/h2-4,18H,1H3,(H2,14,16)(H,15,17) |
| InChIKey | YBLMXDODJFYUPR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.56 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|