C10H9ClF2N2OS — CID 83088109
3-amino-N-(2-chloro-4,6-difluorophenyl)-2-methyl-3-sulfanylidenepropanamide (PubChem CID 83088109) has the molecular formula C10H9ClF2N2OS and a molecular weight of 278.71 g/mol. Its IUPAC name is 3-amino-N-(2-chloro-4,6-difluorophenyl)-2-methyl-3-sulfanylidenepropanamide.
| Compound Name | 3-amino-N-(2-chloro-4,6-difluorophenyl)-2-methyl-3-sulfanylidenepropanamide |
|---|---|
| PubChem CID | 83088109 |
| Molecular Formula | C10H9ClF2N2OS |
| Molecular Weight | 278.71 g/mol |
| Exact Mass | 278.01 |
| IUPAC Name | 3-amino-N-(2-chloro-4,6-difluorophenyl)-2-methyl-3-sulfanylidenepropanamide |
| SMILES | CC(C(=O)Nc1c(F)cc(F)cc1Cl)C(N)=S |
| InChI | InChI=1S/C10H9ClF2N2OS/c1-4(9(14)17)10(16)15-8-6(11)2-5(12)3-7(8)13/h2-4H,1H3,(H2,14,17)(H,15,16) |
| InChIKey | ZEUBBJVJHWDACI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.71 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|