C8H7ClF2N2O — CID 21161536
1-(2-chloro-4,6-difluorophenyl)-3-methylurea (PubChem CID 21161536) has the molecular formula C8H7ClF2N2O and a molecular weight of 220.61 g/mol. Its IUPAC name is 1-(2-chloro-4,6-difluorophenyl)-3-methylurea.
| Compound Name | 1-(2-chloro-4,6-difluorophenyl)-3-methylurea |
|---|---|
| PubChem CID | 21161536 |
| Molecular Formula | C8H7ClF2N2O |
| Molecular Weight | 220.61 g/mol |
| Exact Mass | 220.02 |
| IUPAC Name | 1-(2-chloro-4,6-difluorophenyl)-3-methylurea |
| SMILES | CNC(=O)Nc1c(F)cc(F)cc1Cl |
| InChI | InChI=1S/C8H7ClF2N2O/c1-12-8(14)13-7-5(9)2-4(10)3-6(7)11/h2-3H,1H3,(H2,12,13,14) |
| InChIKey | SJDXRXONOUGAKP-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.61 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |