C10H11ClF2N2O — CID 115871702
1-(2-chloro-4,6-difluorophenyl)-3-propan-2-ylurea (PubChem CID 115871702) has the molecular formula C10H11ClF2N2O and a molecular weight of 248.66 g/mol. Its IUPAC name is 1-(2-chloro-4,6-difluorophenyl)-3-propan-2-ylurea.
| Compound Name | 1-(2-chloro-4,6-difluorophenyl)-3-propan-2-ylurea |
|---|---|
| PubChem CID | 115871702 |
| Molecular Formula | C10H11ClF2N2O |
| Molecular Weight | 248.66 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | 1-(2-chloro-4,6-difluorophenyl)-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)Nc1c(F)cc(F)cc1Cl |
| InChI | InChI=1S/C10H11ClF2N2O/c1-5(2)14-10(16)15-9-7(11)3-6(12)4-8(9)13/h3-5H,1-2H3,(H2,14,15,16) |
| InChIKey | MGJQXCLGFQRZNT-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.66 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |