C13H15ClF2N2O3 — CID 83072644
3-[[(2-chloro-4,6-difluorophenyl)carbamoylamino]methyl]pentanoic acid (PubChem CID 83072644) has the molecular formula C13H15ClF2N2O3 and a molecular weight of 320.72 g/mol. Its IUPAC name is 3-[[(2-chloro-4,6-difluorophenyl)carbamoylamino]methyl]pentanoic acid.
| Compound Name | 3-[[(2-chloro-4,6-difluorophenyl)carbamoylamino]methyl]pentanoic acid |
|---|---|
| PubChem CID | 83072644 |
| Molecular Formula | C13H15ClF2N2O3 |
| Molecular Weight | 320.72 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 3-[[(2-chloro-4,6-difluorophenyl)carbamoylamino]methyl]pentanoic acid |
| SMILES | CCC(CNC(=O)Nc1c(F)cc(F)cc1Cl)CC(=O)O |
| InChI | InChI=1S/C13H15ClF2N2O3/c1-2-7(3-11(19)20)6-17-13(21)18-12-9(14)4-8(15)5-10(12)16/h4-5,7H,2-3,6H2,1H3,(H,19,20)(H2,17,18,21) |
| InChIKey | FGDJGNSHMWQTOW-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.72 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |