C11H13ClF2N2O — CID 115871717
1-butyl-3-(2-chloro-4,6-difluorophenyl)urea (PubChem CID 115871717) has the molecular formula C11H13ClF2N2O and a molecular weight of 262.69 g/mol. Its IUPAC name is 1-butyl-3-(2-chloro-4,6-difluorophenyl)urea.
| Compound Name | 1-butyl-3-(2-chloro-4,6-difluorophenyl)urea |
|---|---|
| PubChem CID | 115871717 |
| Molecular Formula | C11H13ClF2N2O |
| Molecular Weight | 262.69 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 1-butyl-3-(2-chloro-4,6-difluorophenyl)urea |
| SMILES | CCCCNC(=O)Nc1c(F)cc(F)cc1Cl |
| InChI | InChI=1S/C11H13ClF2N2O/c1-2-3-4-15-11(17)16-10-8(12)5-7(13)6-9(10)14/h5-6H,2-4H2,1H3,(H2,15,16,17) |
| InChIKey | UQXKCBQBWZSWNQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.69 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|