5-[(2,6-dichloro-4-fluorophenyl)carbamoylamino]pentanoic acid

C12H13Cl2FN2O3 — CID 83079136

IUPAC5-[(2,6-dichloro-4-fluorophenyl)carbamoylamino]pentanoic acid
SMILESO=C(O)CCCCNC(=O)Nc1c(Cl)cc(F)cc1Cl
InChIInChI=1S/C12H13Cl2FN2O3/c13-8-5-7(15)6-9(14)11(8)17-12(20)16-4-2-1-3-10(18)19/h5-6H,1-4H2,(H,18,19)(H2,16,17,20)
InChIKeyRQZOTXUNLGWIBN-UHFFFAOYSA-N
MW323.15 g/mol
LogP3.51
Rot. Bonds6

About 5-[(2,6-dichloro-4-fluorophenyl)carbamoylamino]pentanoic acid

5-[(2,6-dichloro-4-fluorophenyl)carbamoylamino]pentanoic acid (PubChem CID 83079136) has the molecular formula C12H13Cl2FN2O3 and a molecular weight of 323.15 g/mol. Its IUPAC name is 5-[(2,6-dichloro-4-fluorophenyl)carbamoylamino]pentanoic acid.

Molecular Properties

Compound Name5-[(2,6-dichloro-4-fluorophenyl)carbamoylamino]pentanoic acid
PubChem CID83079136
Molecular FormulaC12H13Cl2FN2O3
Molecular Weight323.15 g/mol
Exact Mass322.03
IUPAC Name5-[(2,6-dichloro-4-fluorophenyl)carbamoylamino]pentanoic acid
SMILESO=C(O)CCCCNC(=O)Nc1c(Cl)cc(F)cc1Cl
InChIInChI=1S/C12H13Cl2FN2O3/c13-8-5-7(15)6-9(14)11(8)17-12(20)16-4-2-1-3-10(18)19/h5-6H,1-4H2,(H,18,19)(H2,16,17,20)
InChIKeyRQZOTXUNLGWIBN-UHFFFAOYSA-N
XLogP3.51
TPSA78.43 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500323.15
LogP ≤ 53.51
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 5-[(2,6-dichloro-4-fluorophenyl)carbamoylamino]pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-[(2,6-dichloro-4-fluorophenyl)carbamoylamino]pentanoic acid?
The IUPAC name of 5-[(2,6-dichloro-4-fluorophenyl)carbamoylamino]pentanoic acid (CID 83079136) is 5-[(2,6-dichloro-4-fluorophenyl)carbamoylamino]pentanoic acid.
What is the SMILES notation for 5-[(2,6-dichloro-4-fluorophenyl)carbamoylamino]pentanoic acid?
The canonical SMILES for 5-[(2,6-dichloro-4-fluorophenyl)carbamoylamino]pentanoic acid is O=C(O)CCCCNC(=O)Nc1c(Cl)cc(F)cc1Cl.
What is the InChIKey of 5-[(2,6-dichloro-4-fluorophenyl)carbamoylamino]pentanoic acid?
The InChIKey is RQZOTXUNLGWIBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13Cl2FN2O3/c13-8-5-7(15)6-9(14)11(8)17-12(20)16-4-2-1-3-10(18)19/h5-6H,1-4H2,(H,18,19)(H2,16,17,20).
What are the key properties of 5-[(2,6-dichloro-4-fluorophenyl)carbamoylamino]pentanoic acid?
5-[(2,6-dichloro-4-fluorophenyl)carbamoylamino]pentanoic acid has a molecular weight of 323.15 g/mol, XLogP of 3.51, 6 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2,6-dichloro-4-fluorophenyl)carbamoylamino]pentanoic acid is sourced from PubChem (CID 83079136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).