C12H14ClF2NO2 — CID 83082133
6-(2-chloro-4,6-difluoroanilino)hexanoic acid (PubChem CID 83082133) has the molecular formula C12H14ClF2NO2 and a molecular weight of 277.70 g/mol. Its IUPAC name is 6-(2-chloro-4,6-difluoroanilino)hexanoic acid.
| Compound Name | 6-(2-chloro-4,6-difluoroanilino)hexanoic acid |
|---|---|
| PubChem CID | 83082133 |
| Molecular Formula | C12H14ClF2NO2 |
| Molecular Weight | 277.70 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 6-(2-chloro-4,6-difluoroanilino)hexanoic acid |
| SMILES | O=C(O)CCCCCNc1c(F)cc(F)cc1Cl |
| InChI | InChI=1S/C12H14ClF2NO2/c13-9-6-8(14)7-10(15)12(9)16-5-3-1-2-4-11(17)18/h6-7,16H,1-5H2,(H,17,18) |
| InChIKey | SJNXAQMQGGMSDD-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.70 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|