4-(3,5-difluoroanilino)butanoic acid

C10H11F2NO2 — CID 18072381

IUPAC4-(3,5-difluoroanilino)butanoic acid
SMILESO=C(O)CCCNc1cc(F)cc(F)c1
InChIInChI=1S/C10H11F2NO2/c11-7-4-8(12)6-9(5-7)13-3-1-2-10(14)15/h4-6,13H,1-3H2,(H,14,15)
InChIKeyWJWREKBINAVBTE-UHFFFAOYSA-N
MW215.20 g/mol
LogP2.24
Rot. Bonds5

About 4-(3,5-difluoroanilino)butanoic acid

4-(3,5-difluoroanilino)butanoic acid (PubChem CID 18072381) has the molecular formula C10H11F2NO2 and a molecular weight of 215.20 g/mol. Its IUPAC name is 4-(3,5-difluoroanilino)butanoic acid.

Molecular Properties

Compound Name4-(3,5-difluoroanilino)butanoic acid
PubChem CID18072381
Molecular FormulaC10H11F2NO2
Molecular Weight215.20 g/mol
Exact Mass215.08
IUPAC Name4-(3,5-difluoroanilino)butanoic acid
SMILESO=C(O)CCCNc1cc(F)cc(F)c1
InChIInChI=1S/C10H11F2NO2/c11-7-4-8(12)6-9(5-7)13-3-1-2-10(14)15/h4-6,13H,1-3H2,(H,14,15)
InChIKeyWJWREKBINAVBTE-UHFFFAOYSA-N
XLogP2.24
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500215.20
LogP ≤ 52.24
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 4-(3,5-difluoroanilino)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(3,5-difluoroanilino)butanoic acid?
The IUPAC name of 4-(3,5-difluoroanilino)butanoic acid (CID 18072381) is 4-(3,5-difluoroanilino)butanoic acid.
What is the SMILES notation for 4-(3,5-difluoroanilino)butanoic acid?
The canonical SMILES for 4-(3,5-difluoroanilino)butanoic acid is O=C(O)CCCNc1cc(F)cc(F)c1.
What is the InChIKey of 4-(3,5-difluoroanilino)butanoic acid?
The InChIKey is WJWREKBINAVBTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F2NO2/c11-7-4-8(12)6-9(5-7)13-3-1-2-10(14)15/h4-6,13H,1-3H2,(H,14,15).
What are the key properties of 4-(3,5-difluoroanilino)butanoic acid?
4-(3,5-difluoroanilino)butanoic acid has a molecular weight of 215.20 g/mol, XLogP of 2.24, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,5-difluoroanilino)butanoic acid is sourced from PubChem (CID 18072381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).