About 5-anilinopentanoic acid
5-anilinopentanoic acid (PubChem CID 28972030) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is 5-anilinopentanoic acid.
Molecular Properties
| Compound Name | 5-anilinopentanoic acid |
| PubChem CID | 28972030 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 5-anilinopentanoic acid |
| SMILES | O=C(O)CCCCNc1ccccc1 |
| InChI | InChI=1S/C11H15NO2/c13-11(14)8-4-5-9-12-10-6-2-1-3-7-10/h1-3,6-7,12H,4-5,8-9H2,(H,13,14) |
| InChIKey | ASHJNTJIYPHTFN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-anilinopentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-anilinopentanoic acid?
The IUPAC name of 5-anilinopentanoic acid (CID 28972030) is 5-anilinopentanoic acid.
What is the SMILES notation for 5-anilinopentanoic acid?
The canonical SMILES for 5-anilinopentanoic acid is O=C(O)CCCCNc1ccccc1.
What is the InChIKey of 5-anilinopentanoic acid?
The InChIKey is ASHJNTJIYPHTFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2/c13-11(14)8-4-5-9-12-10-6-2-1-3-7-10/h1-3,6-7,12H,4-5,8-9H2,(H,13,14).
What are the key properties of 5-anilinopentanoic acid?
5-anilinopentanoic acid has a molecular weight of 193.25 g/mol, XLogP of 2.35, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-anilinopentanoic acid is sourced from PubChem (CID 28972030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).