C15H17NO2 — CID 28972022
5-(naphthalen-2-ylamino)pentanoic acid (PubChem CID 28972022) has the molecular formula C15H17NO2 and a molecular weight of 243.31 g/mol. Its IUPAC name is 5-(naphthalen-2-ylamino)pentanoic acid.
| Compound Name | 5-(naphthalen-2-ylamino)pentanoic acid |
|---|---|
| PubChem CID | 28972022 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | 5-(naphthalen-2-ylamino)pentanoic acid |
| SMILES | O=C(O)CCCCNc1ccc2ccccc2c1 |
| InChI | InChI=1S/C15H17NO2/c17-15(18)7-3-4-10-16-14-9-8-12-5-1-2-6-13(12)11-14/h1-2,5-6,8-9,11,16H,3-4,7,10H2,(H,17,18) |
| InChIKey | CYWZVHVGKXHKHX-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|