C16H22N2 — CID 83955962
N'-naphthalen-2-ylhexane-1,6-diamine (PubChem CID 83955962) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is N'-naphthalen-2-ylhexane-1,6-diamine.
| Compound Name | N'-naphthalen-2-ylhexane-1,6-diamine |
|---|---|
| PubChem CID | 83955962 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | N'-naphthalen-2-ylhexane-1,6-diamine |
| SMILES | NCCCCCCNc1ccc2ccccc2c1 |
| InChI | InChI=1S/C16H22N2/c17-11-5-1-2-6-12-18-16-10-9-14-7-3-4-8-15(14)13-16/h3-4,7-10,13,18H,1-2,5-6,11-12,17H2 |
| InChIKey | UQAHXOODMIITDL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|