About 7-(8-aminooctylamino)-3-(trihydroxy-λ4-sulfanyl)naphthalen-1-ol
7-(8-aminooctylamino)-3-(trihydroxy-λ4-sulfanyl)naphthalen-1-ol (PubChem CID 23385799) has the molecular formula C18H28N2O4S
and a molecular weight of 368.50 g/mol. Its IUPAC name is 7-(8-aminooctylamino)-3-(trihydroxy-λ4-sulfanyl)naphthalen-1-ol.
Molecular Properties
| Compound Name | 7-(8-aminooctylamino)-3-(trihydroxy-λ4-sulfanyl)naphthalen-1-ol |
| PubChem CID | 23385799 |
| Molecular Formula | C18H28N2O4S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 7-(8-aminooctylamino)-3-(trihydroxy-λ4-sulfanyl)naphthalen-1-ol |
| SMILES | NCCCCCCCCNc1ccc2cc(S(O)(O)O)cc(O)c2c1 |
| InChI | InChI=1S/C18H28N2O4S/c19-9-5-3-1-2-4-6-10-20-15-8-7-14-11-16(25(22,23)24)13-18(21)17(14)12-15/h7-8,11-13,20-24H,1-6,9-10,19H2 |
| InChIKey | LINYCMSJAVHQQL-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-(8-aminooctylamino)-3-(trihydroxy-λ4-sulfanyl)naphthalen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(8-aminooctylamino)-3-(trihydroxy-λ4-sulfanyl)naphthalen-1-ol?
The IUPAC name of 7-(8-aminooctylamino)-3-(trihydroxy-λ4-sulfanyl)naphthalen-1-ol (CID 23385799) is 7-(8-aminooctylamino)-3-(trihydroxy-λ4-sulfanyl)naphthalen-1-ol.
What is the SMILES notation for 7-(8-aminooctylamino)-3-(trihydroxy-λ4-sulfanyl)naphthalen-1-ol?
The canonical SMILES for 7-(8-aminooctylamino)-3-(trihydroxy-λ4-sulfanyl)naphthalen-1-ol is NCCCCCCCCNc1ccc2cc(S(O)(O)O)cc(O)c2c1.
What is the InChIKey of 7-(8-aminooctylamino)-3-(trihydroxy-λ4-sulfanyl)naphthalen-1-ol?
The InChIKey is LINYCMSJAVHQQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28N2O4S/c19-9-5-3-1-2-4-6-10-20-15-8-7-14-11-16(25(22,23)24)13-18(21)17(14)12-15/h7-8,11-13,20-24H,1-6,9-10,19H2.
What are the key properties of 7-(8-aminooctylamino)-3-(trihydroxy-λ4-sulfanyl)naphthalen-1-ol?
7-(8-aminooctylamino)-3-(trihydroxy-λ4-sulfanyl)naphthalen-1-ol has a molecular weight of 368.50 g/mol, XLogP of 4.84, 10 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(8-aminooctylamino)-3-(trihydroxy-λ4-sulfanyl)naphthalen-1-ol is sourced from PubChem (CID 23385799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).