C10H14F2N2 — CID 83953114
N'-(3,4-difluorophenyl)butane-1,4-diamine (PubChem CID 83953114) has the molecular formula C10H14F2N2 and a molecular weight of 200.23 g/mol. Its IUPAC name is N'-(3,4-difluorophenyl)butane-1,4-diamine.
| Compound Name | N'-(3,4-difluorophenyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 83953114 |
| Molecular Formula | C10H14F2N2 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | N'-(3,4-difluorophenyl)butane-1,4-diamine |
| SMILES | NCCCCNc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C10H14F2N2/c11-9-4-3-8(7-10(9)12)14-6-2-1-5-13/h3-4,7,14H,1-2,5-6,13H2 |
| InChIKey | PFHQZBFLIZLLHZ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|