C7H7F2NS — CID 115227598
(3,4-difluoroanilino)methanethiol (PubChem CID 115227598) has the molecular formula C7H7F2NS and a molecular weight of 175.20 g/mol. Its IUPAC name is (3,4-difluoroanilino)methanethiol.
| Compound Name | (3,4-difluoroanilino)methanethiol |
|---|---|
| PubChem CID | 115227598 |
| Molecular Formula | C7H7F2NS |
| Molecular Weight | 175.20 g/mol |
| Exact Mass | 175.03 |
| IUPAC Name | (3,4-difluoroanilino)methanethiol |
| SMILES | Fc1ccc(NCS)cc1F |
| InChI | InChI=1S/C7H7F2NS/c8-6-2-1-5(10-4-11)3-7(6)9/h1-3,10-11H,4H2 |
| InChIKey | FBJSJCGHIXIBNK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.20 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|