C9H13F2N — CID 143398651
3,4-difluoro-N-methylaniline;ethane (PubChem CID 143398651) has the molecular formula C9H13F2N and a molecular weight of 173.21 g/mol. Its IUPAC name is 3,4-difluoro-N-methylaniline;ethane.
| Compound Name | 3,4-difluoro-N-methylaniline;ethane |
|---|---|
| PubChem CID | 143398651 |
| Molecular Formula | C9H13F2N |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | 3,4-difluoro-N-methylaniline;ethane |
| SMILES | CC.CNc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C7H7F2N.C2H6/c1-10-5-2-3-6(8)7(9)4-5;1-2/h2-4,10H,1H3;1-2H3 |
| InChIKey | KIICZDRUBBZZQZ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |