C8H10F2N2 — CID 144600669
3,4-difluoro-N-methylaniline;methanimine (PubChem CID 144600669) has the molecular formula C8H10F2N2 and a molecular weight of 172.18 g/mol. Its IUPAC name is 3,4-difluoro-N-methylaniline;methanimine.
| Compound Name | 3,4-difluoro-N-methylaniline;methanimine |
|---|---|
| PubChem CID | 144600669 |
| Molecular Formula | C8H10F2N2 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | 3,4-difluoro-N-methylaniline;methanimine |
| SMILES | CNc1ccc(F)c(F)c1.[H]N=C |
| InChI | InChI=1S/C7H7F2N.CH3N/c1-10-5-2-3-6(8)7(9)4-5;1-2/h2-4,10H,1H3;2H,1H2 |
| InChIKey | VBGAUXHQVAASCA-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|