C9H8ClF2NO — CID 102052828
1-chloro-3-(3,4-difluoroanilino)propan-2-one (PubChem CID 102052828) has the molecular formula C9H8ClF2NO and a molecular weight of 219.62 g/mol. Its IUPAC name is 1-chloro-3-(3,4-difluoroanilino)propan-2-one.
| Compound Name | 1-chloro-3-(3,4-difluoroanilino)propan-2-one |
|---|---|
| PubChem CID | 102052828 |
| Molecular Formula | C9H8ClF2NO |
| Molecular Weight | 219.62 g/mol |
| Exact Mass | 219.03 |
| IUPAC Name | 1-chloro-3-(3,4-difluoroanilino)propan-2-one |
| SMILES | O=C(CCl)CNc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C9H8ClF2NO/c10-4-7(14)5-13-6-1-2-8(11)9(12)3-6/h1-3,13H,4-5H2 |
| InChIKey | OOOJJKHUYHGVAV-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.62 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|