C8H8F2N2O — CID 2410802
2-amino-N-(3,4-difluorophenyl)acetamide (PubChem CID 2410802) has the molecular formula C8H8F2N2O and a molecular weight of 186.16 g/mol. Its IUPAC name is 2-amino-N-(3,4-difluorophenyl)acetamide.
| Compound Name | 2-amino-N-(3,4-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 2410802 |
| Molecular Formula | C8H8F2N2O |
| Molecular Weight | 186.16 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | 2-amino-N-(3,4-difluorophenyl)acetamide |
| SMILES | NCC(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C8H8F2N2O/c9-6-2-1-5(3-7(6)10)12-8(13)4-11/h1-3H,4,11H2,(H,12,13) |
| InChIKey | VKEOZYCTTXSZOP-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.16 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |