C11H12F2N2O3 — CID 113002353
ethyl N-[2-(3,4-difluoroanilino)-2-oxoethyl]carbamate (PubChem CID 113002353) has the molecular formula C11H12F2N2O3 and a molecular weight of 258.22 g/mol. Its IUPAC name is ethyl N-[2-(3,4-difluoroanilino)-2-oxoethyl]carbamate.
| Compound Name | ethyl N-[2-(3,4-difluoroanilino)-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 113002353 |
| Molecular Formula | C11H12F2N2O3 |
| Molecular Weight | 258.22 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | ethyl N-[2-(3,4-difluoroanilino)-2-oxoethyl]carbamate |
| SMILES | CCOC(=O)NCC(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H12F2N2O3/c1-2-18-11(17)14-6-10(16)15-7-3-4-8(12)9(13)5-7/h3-5H,2,6H2,1H3,(H,14,17)(H,15,16) |
| InChIKey | ATGIZIRDHLQVOH-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.22 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |