C10H10F2N2O3 — CID 47129041
methyl N-[2-(3,4-difluoroanilino)-2-oxoethyl]carbamate (PubChem CID 47129041) has the molecular formula C10H10F2N2O3 and a molecular weight of 244.20 g/mol. Its IUPAC name is methyl N-[2-(3,4-difluoroanilino)-2-oxoethyl]carbamate.
| Compound Name | methyl N-[2-(3,4-difluoroanilino)-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 47129041 |
| Molecular Formula | C10H10F2N2O3 |
| Molecular Weight | 244.20 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | methyl N-[2-(3,4-difluoroanilino)-2-oxoethyl]carbamate |
| SMILES | COC(=O)NCC(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C10H10F2N2O3/c1-17-10(16)13-5-9(15)14-6-2-3-7(11)8(12)4-6/h2-4H,5H2,1H3,(H,13,16)(H,14,15) |
| InChIKey | NOUPFNUWAVKAEY-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.20 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |