methyl N-[2-(3,4-difluoroanilino)-2-oxoethyl]carbamate

C10H10F2N2O3 — CID 47129041

IUPACmethyl N-[2-(3,4-difluoroanilino)-2-oxoethyl]carbamate
SMILESCOC(=O)NCC(=O)Nc1ccc(F)c(F)c1
InChIInChI=1S/C10H10F2N2O3/c1-17-10(16)13-5-9(15)14-6-2-3-7(11)8(12)4-6/h2-4H,5H2,1H3,(H,13,16)(H,14,15)
InChIKeyNOUPFNUWAVKAEY-UHFFFAOYSA-N
MW244.20 g/mol
LogP1.26
Rot. Bonds3

About methyl N-[2-(3,4-difluoroanilino)-2-oxoethyl]carbamate

methyl N-[2-(3,4-difluoroanilino)-2-oxoethyl]carbamate (PubChem CID 47129041) has the molecular formula C10H10F2N2O3 and a molecular weight of 244.20 g/mol. Its IUPAC name is methyl N-[2-(3,4-difluoroanilino)-2-oxoethyl]carbamate.

Molecular Properties

Compound Namemethyl N-[2-(3,4-difluoroanilino)-2-oxoethyl]carbamate
PubChem CID47129041
Molecular FormulaC10H10F2N2O3
Molecular Weight244.20 g/mol
Exact Mass244.07
IUPAC Namemethyl N-[2-(3,4-difluoroanilino)-2-oxoethyl]carbamate
SMILESCOC(=O)NCC(=O)Nc1ccc(F)c(F)c1
InChIInChI=1S/C10H10F2N2O3/c1-17-10(16)13-5-9(15)14-6-2-3-7(11)8(12)4-6/h2-4H,5H2,1H3,(H,13,16)(H,14,15)
InChIKeyNOUPFNUWAVKAEY-UHFFFAOYSA-N
XLogP1.26
TPSA67.43 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.20
LogP ≤ 51.26
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze methyl N-[2-(3,4-difluoroanilino)-2-oxoethyl]carbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl N-[2-(3,4-difluoroanilino)-2-oxoethyl]carbamate?
The IUPAC name of methyl N-[2-(3,4-difluoroanilino)-2-oxoethyl]carbamate (CID 47129041) is methyl N-[2-(3,4-difluoroanilino)-2-oxoethyl]carbamate.
What is the SMILES notation for methyl N-[2-(3,4-difluoroanilino)-2-oxoethyl]carbamate?
The canonical SMILES for methyl N-[2-(3,4-difluoroanilino)-2-oxoethyl]carbamate is COC(=O)NCC(=O)Nc1ccc(F)c(F)c1.
What is the InChIKey of methyl N-[2-(3,4-difluoroanilino)-2-oxoethyl]carbamate?
The InChIKey is NOUPFNUWAVKAEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F2N2O3/c1-17-10(16)13-5-9(15)14-6-2-3-7(11)8(12)4-6/h2-4H,5H2,1H3,(H,13,16)(H,14,15).
What are the key properties of methyl N-[2-(3,4-difluoroanilino)-2-oxoethyl]carbamate?
methyl N-[2-(3,4-difluoroanilino)-2-oxoethyl]carbamate has a molecular weight of 244.20 g/mol, XLogP of 1.26, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[2-(3,4-difluoroanilino)-2-oxoethyl]carbamate is sourced from PubChem (CID 47129041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).