C16H15F2N3O2 — CID 42663674
2-[(3,4-difluorophenyl)carbamoylamino]-N-(3-methylphenyl)acetamide (PubChem CID 42663674) has the molecular formula C16H15F2N3O2 and a molecular weight of 319.31 g/mol. Its IUPAC name is 2-[(3,4-difluorophenyl)carbamoylamino]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[(3,4-difluorophenyl)carbamoylamino]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 42663674 |
| Molecular Formula | C16H15F2N3O2 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 2-[(3,4-difluorophenyl)carbamoylamino]-N-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)CNC(=O)Nc2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C16H15F2N3O2/c1-10-3-2-4-11(7-10)20-15(22)9-19-16(23)21-12-5-6-13(17)14(18)8-12/h2-8H,9H2,1H3,(H,20,22)(H2,19,21,23) |
| InChIKey | OMBCOXRRQMKJBB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |