C19H25ClN4O2 — CID 119438626
N-[3-(ethylaminomethyl)phenyl]-2-[(3-methylphenyl)carbamoylamino]acetamide;hydrochloride (PubChem CID 119438626) has the molecular formula C19H25ClN4O2 and a molecular weight of 376.89 g/mol. Its IUPAC name is N-[3-(ethylaminomethyl)phenyl]-2-[(3-methylphenyl)carbamoylamino]acetamide;hydrochloride.
| Compound Name | N-[3-(ethylaminomethyl)phenyl]-2-[(3-methylphenyl)carbamoylamino]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119438626 |
| Molecular Formula | C19H25ClN4O2 |
| Molecular Weight | 376.89 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | N-[3-(ethylaminomethyl)phenyl]-2-[(3-methylphenyl)carbamoylamino]acetamide;hydrochloride |
| SMILES | CCNCc1cccc(NC(=O)CNC(=O)Nc2cccc(C)c2)c1.Cl |
| InChI | InChI=1S/C19H24N4O2.ClH/c1-3-20-12-15-7-5-9-17(11-15)22-18(24)13-21-19(25)23-16-8-4-6-14(2)10-16;/h4-11,20H,3,12-13H2,1-2H3,(H,22,24)(H2,21,23,25);1H |
| InChIKey | YXSIIZDYMXLDRB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.89 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |