C18H21N5O3 — CID 55677891
N-[[4-(carbamoylamino)phenyl]methyl]-2-[(3-methylphenyl)carbamoylamino]acetamide (PubChem CID 55677891) has the molecular formula C18H21N5O3 and a molecular weight of 355.40 g/mol. Its IUPAC name is N-[[4-(carbamoylamino)phenyl]methyl]-2-[(3-methylphenyl)carbamoylamino]acetamide.
| Compound Name | N-[[4-(carbamoylamino)phenyl]methyl]-2-[(3-methylphenyl)carbamoylamino]acetamide |
|---|---|
| PubChem CID | 55677891 |
| Molecular Formula | C18H21N5O3 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | N-[[4-(carbamoylamino)phenyl]methyl]-2-[(3-methylphenyl)carbamoylamino]acetamide |
| SMILES | Cc1cccc(NC(=O)NCC(=O)NCc2ccc(NC(N)=O)cc2)c1 |
| InChI | InChI=1S/C18H21N5O3/c1-12-3-2-4-15(9-12)23-18(26)21-11-16(24)20-10-13-5-7-14(8-6-13)22-17(19)25/h2-9H,10-11H2,1H3,(H,20,24)(H3,19,22,25)(H2,21,23,26) |
| InChIKey | OOXRCNAEIRIABC-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 125.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |