C16H16FN3O2 — CID 772239
N-(3-fluorophenyl)-2-[(3-methylphenyl)carbamoylamino]acetamide (PubChem CID 772239) has the molecular formula C16H16FN3O2 and a molecular weight of 301.32 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2-[(3-methylphenyl)carbamoylamino]acetamide.
| Compound Name | N-(3-fluorophenyl)-2-[(3-methylphenyl)carbamoylamino]acetamide |
|---|---|
| PubChem CID | 772239 |
| Molecular Formula | C16H16FN3O2 |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | N-(3-fluorophenyl)-2-[(3-methylphenyl)carbamoylamino]acetamide |
| SMILES | Cc1cccc(NC(=O)NCC(=O)Nc2cccc(F)c2)c1 |
| InChI | InChI=1S/C16H16FN3O2/c1-11-4-2-6-13(8-11)20-16(22)18-10-15(21)19-14-7-3-5-12(17)9-14/h2-9H,10H2,1H3,(H,19,21)(H2,18,20,22) |
| InChIKey | PKKXBXCEISQUTI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |