C10H13N3O2 — CID 47122532
2-[(3-methylphenyl)carbamoylamino]acetamide (PubChem CID 47122532) has the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. Its IUPAC name is 2-[(3-methylphenyl)carbamoylamino]acetamide.
| Compound Name | 2-[(3-methylphenyl)carbamoylamino]acetamide |
|---|---|
| PubChem CID | 47122532 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 2-[(3-methylphenyl)carbamoylamino]acetamide |
| SMILES | Cc1cccc(NC(=O)NCC(N)=O)c1 |
| InChI | InChI=1S/C10H13N3O2/c1-7-3-2-4-8(5-7)13-10(15)12-6-9(11)14/h2-5H,6H2,1H3,(H2,11,14)(H2,12,13,15) |
| InChIKey | URIBTZRECHIGCH-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |