C16H24N4O3 — CID 86983305
3-methyl-2-[[2-[(3-methylphenyl)carbamoylamino]acetyl]amino]pentanamide (PubChem CID 86983305) has the molecular formula C16H24N4O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is 3-methyl-2-[[2-[(3-methylphenyl)carbamoylamino]acetyl]amino]pentanamide.
| Compound Name | 3-methyl-2-[[2-[(3-methylphenyl)carbamoylamino]acetyl]amino]pentanamide |
|---|---|
| PubChem CID | 86983305 |
| Molecular Formula | C16H24N4O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 3-methyl-2-[[2-[(3-methylphenyl)carbamoylamino]acetyl]amino]pentanamide |
| SMILES | CCC(C)C(NC(=O)CNC(=O)Nc1cccc(C)c1)C(N)=O |
| InChI | InChI=1S/C16H24N4O3/c1-4-11(3)14(15(17)22)20-13(21)9-18-16(23)19-12-7-5-6-10(2)8-12/h5-8,11,14H,4,9H2,1-3H3,(H2,17,22)(H,20,21)(H2,18,19,23) |
| InChIKey | XMFHROSNEUMVAO-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |