C20H27N3O2S — CID 55984026
N-(2-ethyl-1-thiophen-2-ylbutyl)-2-[(3-methylphenyl)carbamoylamino]acetamide (PubChem CID 55984026) has the molecular formula C20H27N3O2S and a molecular weight of 373.52 g/mol. Its IUPAC name is N-(2-ethyl-1-thiophen-2-ylbutyl)-2-[(3-methylphenyl)carbamoylamino]acetamide.
| Compound Name | N-(2-ethyl-1-thiophen-2-ylbutyl)-2-[(3-methylphenyl)carbamoylamino]acetamide |
|---|---|
| PubChem CID | 55984026 |
| Molecular Formula | C20H27N3O2S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | N-(2-ethyl-1-thiophen-2-ylbutyl)-2-[(3-methylphenyl)carbamoylamino]acetamide |
| SMILES | CCC(CC)C(NC(=O)CNC(=O)Nc1cccc(C)c1)c1cccs1 |
| InChI | InChI=1S/C20H27N3O2S/c1-4-15(5-2)19(17-10-7-11-26-17)23-18(24)13-21-20(25)22-16-9-6-8-14(3)12-16/h6-12,15,19H,4-5,13H2,1-3H3,(H,23,24)(H2,21,22,25) |
| InChIKey | JCCLKYXERGIWAE-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |