C20H27NO3S — CID 55903263
N-(2-ethyl-1-thiophen-2-ylbutyl)-2-(2-methoxy-4-methylphenoxy)acetamide (PubChem CID 55903263) has the molecular formula C20H27NO3S and a molecular weight of 361.51 g/mol. Its IUPAC name is N-(2-ethyl-1-thiophen-2-ylbutyl)-2-(2-methoxy-4-methylphenoxy)acetamide.
| Compound Name | N-(2-ethyl-1-thiophen-2-ylbutyl)-2-(2-methoxy-4-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 55903263 |
| Molecular Formula | C20H27NO3S |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | N-(2-ethyl-1-thiophen-2-ylbutyl)-2-(2-methoxy-4-methylphenoxy)acetamide |
| SMILES | CCC(CC)C(NC(=O)COc1ccc(C)cc1OC)c1cccs1 |
| InChI | InChI=1S/C20H27NO3S/c1-5-15(6-2)20(18-8-7-11-25-18)21-19(22)13-24-16-10-9-14(3)12-17(16)23-4/h7-12,15,20H,5-6,13H2,1-4H3,(H,21,22) |
| InChIKey | WUGNPKPULOSQJF-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |