C13H19N3O2S — CID 119438522
2-[2-[3-(ethylaminomethyl)anilino]-2-oxoethyl]sulfanylacetamide (PubChem CID 119438522) has the molecular formula C13H19N3O2S and a molecular weight of 281.38 g/mol. Its IUPAC name is 2-[2-[3-(ethylaminomethyl)anilino]-2-oxoethyl]sulfanylacetamide.
| Compound Name | 2-[2-[3-(ethylaminomethyl)anilino]-2-oxoethyl]sulfanylacetamide |
|---|---|
| PubChem CID | 119438522 |
| Molecular Formula | C13H19N3O2S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 2-[2-[3-(ethylaminomethyl)anilino]-2-oxoethyl]sulfanylacetamide |
| SMILES | CCNCc1cccc(NC(=O)CSCC(N)=O)c1 |
| InChI | InChI=1S/C13H19N3O2S/c1-2-15-7-10-4-3-5-11(6-10)16-13(18)9-19-8-12(14)17/h3-6,15H,2,7-9H2,1H3,(H2,14,17)(H,16,18) |
| InChIKey | DXGNVHVSDFBCRL-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |