C9H13FN2 — CID 28766537
N'-(4-fluorophenyl)propane-1,3-diamine (PubChem CID 28766537) has the molecular formula C9H13FN2 and a molecular weight of 168.22 g/mol. Its IUPAC name is N'-(4-fluorophenyl)propane-1,3-diamine.
| Compound Name | N'-(4-fluorophenyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 28766537 |
| Molecular Formula | C9H13FN2 |
| Molecular Weight | 168.22 g/mol |
| Exact Mass | 168.11 |
| IUPAC Name | N'-(4-fluorophenyl)propane-1,3-diamine |
| SMILES | NCCCNc1ccc(F)cc1 |
| InChI | InChI=1S/C9H13FN2/c10-8-2-4-9(5-3-8)12-7-1-6-11/h2-5,12H,1,6-7,11H2 |
| InChIKey | QWOMWKRCVFRAGA-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.22 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|