C12H18N2O — CID 117097718
N'-(4-prop-2-enoxyphenyl)propane-1,3-diamine (PubChem CID 117097718) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is N'-(4-prop-2-enoxyphenyl)propane-1,3-diamine.
| Compound Name | N'-(4-prop-2-enoxyphenyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 117097718 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | N'-(4-prop-2-enoxyphenyl)propane-1,3-diamine |
| SMILES | C=CCOc1ccc(NCCCN)cc1 |
| InChI | InChI=1S/C12H18N2O/c1-2-10-15-12-6-4-11(5-7-12)14-9-3-8-13/h2,4-7,14H,1,3,8-10,13H2 |
| InChIKey | UIWMAMWCHNBHFL-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|