C12H16N2O2 — CID 54821477
N-methyl-2-(4-prop-2-enoxyanilino)acetamide (PubChem CID 54821477) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is N-methyl-2-(4-prop-2-enoxyanilino)acetamide.
| Compound Name | N-methyl-2-(4-prop-2-enoxyanilino)acetamide |
|---|---|
| PubChem CID | 54821477 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | N-methyl-2-(4-prop-2-enoxyanilino)acetamide |
| SMILES | C=CCOc1ccc(NCC(=O)NC)cc1 |
| InChI | InChI=1S/C12H16N2O2/c1-3-8-16-11-6-4-10(5-7-11)14-9-12(15)13-2/h3-7,14H,1,8-9H2,2H3,(H,13,15) |
| InChIKey | IZYZZMQPHFNODH-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|