C25H26N2O4 — CID 54822985
2-[4-(2-phenoxyethoxy)anilino]-N-(3-prop-2-enoxyphenyl)acetamide (PubChem CID 54822985) has the molecular formula C25H26N2O4 and a molecular weight of 418.49 g/mol. Its IUPAC name is 2-[4-(2-phenoxyethoxy)anilino]-N-(3-prop-2-enoxyphenyl)acetamide.
| Compound Name | 2-[4-(2-phenoxyethoxy)anilino]-N-(3-prop-2-enoxyphenyl)acetamide |
|---|---|
| PubChem CID | 54822985 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 2-[4-(2-phenoxyethoxy)anilino]-N-(3-prop-2-enoxyphenyl)acetamide |
| SMILES | C=CCOc1cccc(NC(=O)CNc2ccc(OCCOc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C25H26N2O4/c1-2-15-29-24-10-6-7-21(18-24)27-25(28)19-26-20-11-13-23(14-12-20)31-17-16-30-22-8-4-3-5-9-22/h2-14,18,26H,1,15-17,19H2,(H,27,28) |
| InChIKey | RXTYFDKWFWQSMT-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|