C16H18ClFN2O — CID 117097753
N'-[4-[(4-chloro-2-fluorophenyl)methoxy]phenyl]propane-1,3-diamine (PubChem CID 117097753) has the molecular formula C16H18ClFN2O and a molecular weight of 308.78 g/mol. Its IUPAC name is N'-[4-[(4-chloro-2-fluorophenyl)methoxy]phenyl]propane-1,3-diamine.
| Compound Name | N'-[4-[(4-chloro-2-fluorophenyl)methoxy]phenyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 117097753 |
| Molecular Formula | C16H18ClFN2O |
| Molecular Weight | 308.78 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | N'-[4-[(4-chloro-2-fluorophenyl)methoxy]phenyl]propane-1,3-diamine |
| SMILES | NCCCNc1ccc(OCc2ccc(Cl)cc2F)cc1 |
| InChI | InChI=1S/C16H18ClFN2O/c17-13-3-2-12(16(18)10-13)11-21-15-6-4-14(5-7-15)20-9-1-8-19/h2-7,10,20H,1,8-9,11,19H2 |
| InChIKey | KVRNEQRYXUGBMP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.78 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|