C15H16ClFN2O — CID 117097512
N'-[4-[(4-chloro-2-fluorophenyl)methoxy]phenyl]ethane-1,2-diamine (PubChem CID 117097512) has the molecular formula C15H16ClFN2O and a molecular weight of 294.76 g/mol. Its IUPAC name is N'-[4-[(4-chloro-2-fluorophenyl)methoxy]phenyl]ethane-1,2-diamine.
| Compound Name | N'-[4-[(4-chloro-2-fluorophenyl)methoxy]phenyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 117097512 |
| Molecular Formula | C15H16ClFN2O |
| Molecular Weight | 294.76 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | N'-[4-[(4-chloro-2-fluorophenyl)methoxy]phenyl]ethane-1,2-diamine |
| SMILES | NCCNc1ccc(OCc2ccc(Cl)cc2F)cc1 |
| InChI | InChI=1S/C15H16ClFN2O/c16-12-2-1-11(15(17)9-12)10-20-14-5-3-13(4-6-14)19-8-7-18/h1-6,9,19H,7-8,10,18H2 |
| InChIKey | FNIAEORPWFHUOV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.76 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|