C17H21ClN2O — CID 117097524
N'-[4-[(2-chlorophenyl)methoxy]phenyl]butane-1,4-diamine (PubChem CID 117097524) has the molecular formula C17H21ClN2O and a molecular weight of 304.82 g/mol. Its IUPAC name is N'-[4-[(2-chlorophenyl)methoxy]phenyl]butane-1,4-diamine.
| Compound Name | N'-[4-[(2-chlorophenyl)methoxy]phenyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 117097524 |
| Molecular Formula | C17H21ClN2O |
| Molecular Weight | 304.82 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | N'-[4-[(2-chlorophenyl)methoxy]phenyl]butane-1,4-diamine |
| SMILES | NCCCCNc1ccc(OCc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C17H21ClN2O/c18-17-6-2-1-5-14(17)13-21-16-9-7-15(8-10-16)20-12-4-3-11-19/h1-2,5-10,20H,3-4,11-13,19H2 |
| InChIKey | KAYVAPVENZPULX-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.82 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|